EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O5 |
| Net Charge | 0 |
| Average Mass | 330.380 |
| Monoisotopic Mass | 330.14672 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]23CC=C[C@@]1(C)C(=O)O3 |
| InChI | InChI=1S/C19H22O5/c1-10-8-17-9-18(10,23)7-4-11(17)19-6-3-5-16(2,15(22)24-19)13(19)12(17)14(20)21/h3,5,11-13,23H,1,4,6-9H2,2H3,(H,20,21)/t11-,12-,13-,16-,17+,18+,19-/m1/s1 |
| InChIKey | ZOWHLBOPCIHIHW-KQBHUUJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A5 (CHEBI:29598) has role mouse metabolite (CHEBI:75771) |
| gibberellin A5 (CHEBI:29598) has role plant metabolite (CHEBI:76924) |
| gibberellin A5 (CHEBI:29598) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A5 (CHEBI:29598) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A5 (CHEBI:29598) is a lactone (CHEBI:25000) |
| IUPAC Names |
|---|
| (1R,2R,5S,8S,9S,10R,11R)-5-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-12-ene-9-carboxylic acid |
| 7α-hydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibb-3-ene-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA5 | ChEBI |
| Gibberellin A5 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000005 | KNApSAcK |
| C11871 | KEGG COMPOUND |
| CPD-15217 | MetaCyc |
| LMPR0104170028 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1296940 | Reaxys |
| CAS:561-56-8 | KEGG COMPOUND |
| Citations |
|---|