EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29596 - gibberellin A37
| Formula | C20H26O5 |
| Net Charge | 0 |
| Average Mass | 346.423 |
| Monoisotopic Mass | 346.17802 |
| SMILES | [H][C@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@@H](C(=O)O)[C@@]1([H])[C@@]32CC[C@H](O)[C@@]1(C)C(=O)OC2 |
| InChI | InChI=1S/C20H26O5/c1-10-7-20-8-11(10)3-4-12(20)19-6-5-13(21)18(2,17(24)25-9-19)15(19)14(20)16(22)23/h11-15,21H,1,3-9H2,2H3,(H,22,23)/t11-,12+,13+,14-,15-,18-,19-,20+/m1/s1 |
| InChIKey | QYXZQZMPZUEEML-SQLMURCQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A37 (CHEBI:29596) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A37 (CHEBI:29596) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A37 (CHEBI:29596) is a lactone (CHEBI:25000) |
| IUPAC Names |
|---|
| (1R,2R,5R,8R,9S,10S,11S,17S)-17-hydroxy-11-methyl-6-methylidene-12-oxo-13-oxapentacyclo[9.3.3.15,8.01,10.02,8]octadecane-9-carboxylic acid |
| 2β-hydroxy-1β-methyl-8-methylidene-12-oxo-1α,4a-(methanooxymethano)-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA37 | ChEBI |
| Gibberellin A37 open lactone | KEGG COMPOUND |