EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C=O)CC[C@H](O)[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-10-7-20-8-11(10)3-4-12(20)19(9-21)6-5-13(22)18(2,17(25)26)15(19)14(20)16(23)24/h9,11-15,22H,1,3-8H2,2H3,(H,23,24)(H,25,26)/t11-,12+,13+,14-,15-,18-,19-,20+/m1/s1 |
| InChIKey | JZBLVVPDEDCVQA-SQLMURCQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A36 (CHEBI:29595) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A36 (CHEBI:29595) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Names |
|---|
| (1R,2S,3S,4S,5S,8R,9R,12R)-8-formyl-5-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| 4a-formyl-2β-hydroxy-1β-methyl-8-methylidene-4aα,4bβ-gibbane-1α,10β-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| Gibberellin A36 | KEGG COMPOUND |
| GA36 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C11862 | KEGG COMPOUND |
| LMPR0104170019 | LIPID MAPS |
| C00000036 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2955378 | Beilstein |
| CAS:38076-57-2 | KEGG COMPOUND |