EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O6 |
| Net Charge | 0 |
| Average Mass | 348.395 |
| Monoisotopic Mass | 348.15729 |
| SMILES | [H][C@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@@H](C(=O)O)[C@@]1([H])[C@@]32C[C@H](O)[C@H](O)[C@@]1(C)C(=O)O2 |
| InChI | InChI=1S/C19H24O6/c1-8-5-18-6-9(8)3-4-11(18)19-7-10(20)14(21)17(2,16(24)25-19)13(19)12(18)15(22)23/h9-14,20-21H,1,3-7H2,2H3,(H,22,23)/t9-,10+,11-,12-,13-,14+,17+,18+,19-/m1/s1 |
| InChIKey | IGZIQAJJXGRAJF-TXZPEUJSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A34 (CHEBI:29593) is a C19-gibberellin (CHEBI:20858) |
| gibberellin A34 (CHEBI:29593) is a gibberellin monocarboxylic acid (CHEBI:38305) |
| gibberellin A34 (CHEBI:29593) is a lactone (CHEBI:25000) |
| gibberellin A34 (CHEBI:29593) is conjugate acid of gibberellin A34(1−) (CHEBI:73258) |
| Incoming Relation(s) |
| gibberellin A34(1−) (CHEBI:73258) is conjugate base of gibberellin A34 (CHEBI:29593) |
| IUPAC Names |
|---|
| (1R,2R,5R,8R,9S,10R,11S,12R,13S)-12,13-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| 2β,3β-dihydroxy-1β-methyl-8-methylidene-13-oxo-4a,1α-epoxymethano-4aα,4bβ-gibbane-10β-carboxylic acid |
| Synonyms | Source |
|---|---|
| GA34 | ChEBI |
| Gibberellin A34 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000034 | KNApSAcK |
| C11868 | KEGG COMPOUND |
| CPD-6224 | MetaCyc |
| LMPR0104170025 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1440354 | Beilstein |
| Beilstein:1440355 | Beilstein |
| CAS:32630-92-5 | KEGG COMPOUND |