EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35N3Sn |
| Net Charge | 0 |
| Average Mass | 436.232 |
| Monoisotopic Mass | 437.18529 |
| SMILES | c1nc[n]([Sn]([CH]2CCCCC2)([CH]2CCCCC2)[CH]2CCCCC2)n1 |
| InChI | InChI=1S/3C6H11.C2H2N3.Sn/c3*1-2-4-6-5-3-1;1-3-2-5-4-1;/h3*1H,2-6H2;1-2H;/q;;;-1;+1 |
| InChIKey | ONHBDDJJTDTLIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azocyclotin (CHEBI:2959) is a organotin acaricide (CHEBI:39292) |
| azocyclotin (CHEBI:2959) is a triazoles (CHEBI:35727) |
| IUPAC Names |
|---|
| 1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
| tricyclohexyl(1H-1,2,4-triazol-1-yl)tin |
| Synonyms | Source |
|---|---|
| (1H-1,2,4-triazol-1-yl)tricyclohexylstannane | ChemIDplus |
| (1H-1,2,4-triazolyl)tricyclohexylstannane | ChemIDplus |
| Azocyclotin | KEGG COMPOUND |
| Peropal | ChemIDplus |
| tri(cyclohexyl)-1H-1,2,4-triazol-1-yltin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 53 | PPDB |
| azocyclotin | Alan Wood's Pesticides |
| C11092 | KEGG COMPOUND |
| CN101380025 | Patent |
| CN101380026 | Patent |
| CN101491256 | Patent |
| CN1729780 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:621636 | Reaxys |
| CAS:41083-11-8 | KEGG COMPOUND |
| CAS:41083-11-8 | ChemIDplus |
| Citations |
|---|