EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H69NO12 |
| Net Charge | 0 |
| Average Mass | 792.020 |
| Monoisotopic Mass | 791.48198 |
| SMILES | [H][C@@]12O[C@@](O)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@H](/C(C)=C/[C@@H]3CC[C@@H](O)[C@H](OC)C3)[C@H](C)[C@@H](O)CC(=O)[C@H](CC)/C=C(\C)C[C@H](C)C[C@@H]1OC)[C@H](C)C[C@@H]2OC |
| InChI | InChI=1S/C43H69NO12/c1-10-30-18-24(2)17-25(3)19-36(53-8)39-37(54-9)21-27(5)43(51,56-39)40(48)41(49)44-16-12-11-13-31(44)42(50)55-38(28(6)33(46)23-34(30)47)26(4)20-29-14-15-32(45)35(22-29)52-7/h18,20,25,27-33,35-39,45-46,51H,10-17,19,21-23H2,1-9H3/b24-18+,26-20+/t25-,27+,28+,29-,30+,31-,32+,33-,35+,36-,37-,38+,39+,43+/m0/s1 |
| InChIKey | ZDQSOHOQTUFQEM-NURRSENYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascomycin (CHEBI:29582) has role antifungal agent (CHEBI:35718) |
| ascomycin (CHEBI:29582) has role bacterial metabolite (CHEBI:76969) |
| ascomycin (CHEBI:29582) has role immunosuppressive agent (CHEBI:35705) |
| ascomycin (CHEBI:29582) is a ether (CHEBI:25698) |
| ascomycin (CHEBI:29582) is a lactol (CHEBI:38131) |
| ascomycin (CHEBI:29582) is a macrolide (CHEBI:25106) |
| ascomycin (CHEBI:29582) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,4R,5S,8R,9E,12S,14S,15R,16S,18R,19R,26aS)-8-ethyl-5,19-dihydroxy-3-{(1E)-1-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]prop-1-en-2-yl}-14,16-dimethoxy-4,10,12,18-tetramethyl-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a-hexadecahydro-3H-15,19-epoxypyrido[2,1-c][1,4]oxazacyclotricosine-1,7,20,21(4H,23H)-tetrone |
| Synonyms | Source |
|---|---|
| FK 520 | ChemIDplus |
| FK520 | KEGG COMPOUND |
| FR 900520 | ChemIDplus |
| Immunomycin | KEGG COMPOUND |
| L 683590 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5372600 | Reaxys |
| CAS:104987-12-4 | ChemIDplus |
| CAS:104987-12-4 | KEGG COMPOUND |
| Citations |
|---|