EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H69NO12 |
| Net Charge | 0 |
| Average Mass | 792.020 |
| Monoisotopic Mass | 791.48198 |
| SMILES | [H][C@@]12O[C@@](O)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@H](/C(C)=C/[C@@H]3CC[C@@H](O)[C@H](OC)C3)[C@H](C)[C@@H](O)CC(=O)[C@H](CC)/C=C(\C)C[C@H](C)C[C@@H]1OC)[C@H](C)C[C@@H]2OC |
| InChI | InChI=1S/C43H69NO12/c1-10-30-18-24(2)17-25(3)19-36(53-8)39-37(54-9)21-27(5)43(51,56-39)40(48)41(49)44-16-12-11-13-31(44)42(50)55-38(28(6)33(46)23-34(30)47)26(4)20-29-14-15-32(45)35(22-29)52-7/h18,20,25,27-33,35-39,45-46,51H,10-17,19,21-23H2,1-9H3/b24-18+,26-20+/t25-,27+,28+,29-,30+,31-,32+,33-,35+,36-,37-,38+,39+,43+/m0/s1 |
| InChIKey | ZDQSOHOQTUFQEM-NURRSENYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascomycin (CHEBI:29582) has role antifungal agent (CHEBI:35718) |
| ascomycin (CHEBI:29582) has role bacterial metabolite (CHEBI:76969) |
| ascomycin (CHEBI:29582) has role immunosuppressive agent (CHEBI:35705) |
| ascomycin (CHEBI:29582) is a ether (CHEBI:25698) |
| ascomycin (CHEBI:29582) is a lactol (CHEBI:38131) |
| ascomycin (CHEBI:29582) is a macrolide (CHEBI:25106) |
| ascomycin (CHEBI:29582) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,4R,5S,8R,9E,12S,14S,15R,16S,18R,19R,26aS)-8-ethyl-5,19-dihydroxy-3-{(1E)-1-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]prop-1-en-2-yl}-14,16-dimethoxy-4,10,12,18-tetramethyl-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a-hexadecahydro-3H-15,19-epoxypyrido[2,1-c][1,4]oxazacyclotricosine-1,7,20,21(4H,23H)-tetrone |
| Synonyms | Source |
|---|---|
| FK520 | KEGG COMPOUND |
| Immunomycin | KEGG COMPOUND |
| FK 520 | ChemIDplus |
| FR 900520 | ChemIDplus |
| L 683590 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5372600 | Reaxys |
| CAS:104987-12-4 | KEGG COMPOUND |
| CAS:104987-12-4 | ChemIDplus |
| Citations |
|---|