EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41NO5S |
| Net Charge | 0 |
| Average Mass | 491.694 |
| Monoisotopic Mass | 491.27054 |
| SMILES | [H][C@@]1(/C(C)=C/c2csc(C)n2)C/C=C(/C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C27H41NO5S/c1-16-9-8-10-17(2)25(31)19(4)26(32)27(6,7)23(29)14-24(30)33-22(12-11-16)18(3)13-21-15-34-20(5)28-21/h11,13,15,17,19,22-23,25,29,31H,8-10,12,14H2,1-7H3/b16-11-,18-13+/t17-,19+,22-,23-,25-/m0/s1 |
| InChIKey | XOZIUKBZLSUILX-GIQCAXHBSA-N |
| Roles Classification |
|---|
| Biological Roles: | microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epothilone D (CHEBI:29579) has role microtubule-stabilising agent (CHEBI:61950) |
| epothilone D (CHEBI:29579) is a epothilone (CHEBI:60831) |
| IUPAC Name |
|---|
| (4S,7R,8S,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9,13-pentamethyl-16-[(1E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]oxacyclohexadec-13-ene-2,6-dione |
| Synonyms | Source |
|---|---|
| 12,13-deoxyepothilone B | ChemIDplus |
| 12,13-desoxyepothilone B | ChemIDplus |
| (−)-desoxyepothilone B | ChemIDplus |
| Epo D | ChEBI |
| (−)-epothilone D | ChemIDplus |
| KOS 862 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| epothilone D | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00028253 | KNApSAcK |
| C12039 | KEGG COMPOUND |
| DB01873 | DrugBank |
| EPD | PDBeChem |
| LMPK04000001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7754058 | Reaxys |
| CAS:189453-10-9 | KEGG COMPOUND |
| CAS:189453-10-9 | ChemIDplus |
| Citations |
|---|