EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C13H30N |
| Net Charge | 0 |
| Average Mass | 280.294 |
| Monoisotopic Mass | 279.15616 |
| SMILES | CCCCCCCCCC[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C13H30N.BrH/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PLMFYJJFUUUCRZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| decyltrimethylammonium bromide (CHEBI:295756) has part decyltrimethylammonium ion (CHEBI:55325) |
| decyltrimethylammonium bromide (CHEBI:295756) has role surfactant (CHEBI:35195) |
| decyltrimethylammonium bromide (CHEBI:295756) is a bromide salt (CHEBI:22925) |
| decyltrimethylammonium bromide (CHEBI:295756) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| N,N,N-trimethyldecan-1-aminium bromide |
| Synonyms | Source |
|---|---|
| DTAB | ChemIDplus |
| n-Decyltrimethylammonium bromide | ChemIDplus |
| N,N,N-Trimethyl-1-decanaminium bromide | ChemIDplus |
| N,N,N-Trimethyldecylammonium bromide | ChemIDplus |
| Trimethyldecylammonium bromide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3915222 | Reaxys |
| CAS:2082-84-0 | ChemIDplus |
| Citations |
|---|