EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2956 - azlocillin
| Formula | C20H23N5O6S |
| Net Charge | 0 |
| Average Mass | 461.500 |
| Monoisotopic Mass | 461.13690 |
| SMILES | [H][C@](NC(=O)N1CCNC1=O)(C(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@]12[H])c1ccccc1 |
| InChI | InChI=1S/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 |
| InChIKey | JTWOMNBEOCYFNV-NFFDBFGFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azlocillin (CHEBI:2956) has role antibacterial drug (CHEBI:36047) |
| azlocillin (CHEBI:2956) is a penicillin (CHEBI:17334) |
| azlocillin (CHEBI:2956) is a penicillin allergen (CHEBI:88187) |
| azlocillin (CHEBI:2956) is a semisynthetic derivative (CHEBI:72588) |
| azlocillin (CHEBI:2956) is conjugate acid of azlocillin(1−) (CHEBI:51863) |
| Incoming Relation(s) |
| azlocillin(1−) (CHEBI:51863) is conjugate base of azlocillin (CHEBI:2956) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(2R)-2-{[(2-oxoimidazolidin-1-yl)carbonyl]amino}-2-phenylacetamido]penam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| azlocilina | ChemIDplus |
| azlocillin | KEGG DRUG |
| azlocilline | ChemIDplus |
| azlocillinum | ChemIDplus |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-{[(2R)-2-{[(2-oxoimidazolidin-1-yl)carbonyl]amino}-2-phenylacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 277 | DrugCentral |
| Azlocillin | Wikipedia |
| C06839 | KEGG COMPOUND |
| CN101585844 | Patent |
| D02339 | KEGG DRUG |
| DB01061 | DrugBank |
| FR2100682 | Patent |
| LSM-15179 | LINCS |
| US3933795 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5785146 | Reaxys |
| CAS:37091-66-0 | KEGG COMPOUND |
| CAS:37091-66-0 | ChemIDplus |
| Citations |
|---|