EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H72N2O12 |
| Net Charge | 0 |
| Average Mass | 748.996 |
| Monoisotopic Mass | 748.50853 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C38H72N2O12/c1-15-27-38(10,46)31(42)24(6)40(13)19-20(2)17-36(8,45)33(52-35-29(41)26(39(11)12)16-21(3)48-35)22(4)30(23(5)34(44)50-27)51-28-18-37(9,47-14)32(43)25(7)49-28/h20-33,35,41-43,45-46H,15-19H2,1-14H3/t20-,21-,22+,23-,24-,25+,26+,27-,28+,29-,30+,31-,32+,33-,35+,36-,37-,38-/m1/s1 |
| InChIKey | MQTOSJVFKKJCRP-BICOPXKESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azithromycin (CHEBI:2955) has role antibacterial drug (CHEBI:36047) |
| azithromycin (CHEBI:2955) has role environmental contaminant (CHEBI:78298) |
| azithromycin (CHEBI:2955) has role xenobiotic (CHEBI:35703) |
| azithromycin (CHEBI:2955) is a macrolide antibiotic (CHEBI:25105) |
| azithromycin (CHEBI:2955) is conjugate base of azithromycin(2+) (CHEBI:231550) |
| Incoming Relation(s) |
| azithromycin dihydrate (CHEBI:34546) has part azithromycin (CHEBI:2955) |
| azithromycin(2+) (CHEBI:231550) is conjugate acid of azithromycin (CHEBI:2955) |
| IUPAC Name |
|---|
| (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-15-oxo-11-{[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy}-1-oxa-6-azacyclopentadecan-13-yl 2,6-dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranoside |
| INNs | Source |
|---|---|
| azithromycine | ChemIDplus |
| azithromycinum | ChemIDplus |
| azitromicina | WHO MedNet |
| Synonym | Source |
|---|---|
| (2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)13-((2,6-Dideoxy-3-C-methyl-3-O-methyl-alpha-L-ribo-hexopyranosyl)oxy)-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-((3,4,6-trideoxy-3-(dimethylamino)-beta-D-xylo-hexopyranosyl)oxy)-1-oxa-6-azacyclopentadecan-15-one | ChemIDplus |
| Brand Names | Source |
|---|---|
| Azenil | DrugBank |
| Azifast | ChEBI |
| Azigram | ChEBI |
| Azimakrol | ChEBI |
| Azitromin | ChEBI |
| Hemomycin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 276 | DrugCentral |
| Azithromycin | Wikipedia |
| BE892357 | Patent |
| C06838 | KEGG COMPOUND |
| D07486 | KEGG DRUG |
| DB00207 | DrugBank |
| HMDB0014352 | HMDB |
| LSM-5821 | LINCS |
| US4517359 | Patent |
| ZIT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5387583 | Reaxys |
| Reaxys:8820027 | Reaxys |
| CAS:83905-01-5 | ChemIDplus |
| Citations |
|---|