EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N3O3PS2 |
| Net Charge | 0 |
| Average Mass | 317.332 |
| Monoisotopic Mass | 317.00577 |
| SMILES | COP(=S)(OC)SCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C10H12N3O3PS2/c1-15-17(18,16-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3 |
| InChIKey | CJJOSEISRRTUQB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azinphos-methyl (CHEBI:2953) has parent hydride 1,2,3-benzotriazine (CHEBI:38586) |
| azinphos-methyl (CHEBI:2953) has role agrochemical (CHEBI:33286) |
| azinphos-methyl (CHEBI:2953) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| azinphos-methyl (CHEBI:2953) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| azinphos-methyl (CHEBI:2953) is a benzotriazines (CHEBI:51361) |
| azinphos-methyl (CHEBI:2953) is a organic thiophosphate (CHEBI:37512) |
| azinphos-methyl (CHEBI:2953) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] phosphorodithioate |
| Synonyms | Source |
|---|---|
| 3-(mercaptomethyl)-1,2,3-benzotriazin-4(3H)-one, O,O-dimethyl phosphorodithioate | ChemIDplus |
| Azinphos methyl | KEGG COMPOUND |
| Azinphos methyl | KEGG COMPOUND |
| Azinphosmethyl | ChemIDplus |
| O,O-dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] dithiophosphate | IUPAC |
| Guthion | ChemIDplus |
| Citations |
|---|