EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H43ClN2O9 |
| Net Charge | 0 |
| Average Mass | 635.154 |
| Monoisotopic Mass | 634.26571 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@@H](OC(=O)C(C)C)CC(=O)N(C)c1cc(cc(OC)c1Cl)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@]([H])(OC(=O)N1)[C@H]2C |
| InChI | InChI=1S/C32H43ClN2O9/c1-17(2)29(37)43-25-15-26(36)35(6)21-13-20(14-22(40-7)27(21)33)12-18(3)10-9-11-24(41-8)32(39)16-23(42-30(38)34-32)19(4)28-31(25,5)44-28/h9-11,13-14,17,19,23-25,28,39H,12,15-16H2,1-8H3,(H,34,38)/b11-9+,18-10+/t19-,23+,24-,25+,28+,31+,32+/m1/s1 |
| InChIKey | OPQNCARIZFLNLF-JBHFWYGFSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ansamitocin P3 (CHEBI:29515) has role antimicrobial agent (CHEBI:33281) |
| ansamitocin P3 (CHEBI:29515) has role antineoplastic agent (CHEBI:35610) |
| ansamitocin P3 (CHEBI:29515) has role metabolite (CHEBI:25212) |
| ansamitocin P3 (CHEBI:29515) is a aromatic ether (CHEBI:35618) |
| ansamitocin P3 (CHEBI:29515) is a carbamate ester (CHEBI:23003) |
| ansamitocin P3 (CHEBI:29515) is a carboxylic ester (CHEBI:33308) |
| ansamitocin P3 (CHEBI:29515) is a epoxide (CHEBI:32955) |
| ansamitocin P3 (CHEBI:29515) is a lactam (CHEBI:24995) |
| ansamitocin P3 (CHEBI:29515) is a macrocycle (CHEBI:51026) |
| ansamitocin P3 (CHEBI:29515) is a monochlorobenzenes (CHEBI:83403) |
| ansamitocin P3 (CHEBI:29515) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10(26),11,13,16,18-pentaen-6-yl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| 2'-De(acetylmethylamino)-2'-methylmaytansine | KEGG COMPOUND |
| ansamitocin P-3 | ChEBI |
| Antibiotic C15003P3 | KEGG COMPOUND |
| C15003P3 | KEGG COMPOUND |
| Maytansinol isobutyrate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00018269 | KNApSAcK |
| C12045 | KEGG COMPOUND |
| LMPK04000039 | LIPID MAPS |
| US2007135629 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5416580 | Reaxys |
| CAS:66584-72-3 | KEGG COMPOUND |
| CAS:66584-72-3 | ChemIDplus |
| Citations |
|---|