EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H43ClN2O9 |
| Net Charge | 0 |
| Average Mass | 635.154 |
| Monoisotopic Mass | 634.26571 |
| SMILES | [H][C@@]12O[C@@]1(C)[C@@H](OC(=O)C(C)C)CC(=O)N(C)c1cc(cc(OC)c1Cl)C/C(C)=C/C=C/[C@@H](OC)[C@@]1(O)C[C@]([H])(OC(=O)N1)[C@H]2C |
| InChI | InChI=1S/C32H43ClN2O9/c1-17(2)29(37)43-25-15-26(36)35(6)21-13-20(14-22(40-7)27(21)33)12-18(3)10-9-11-24(41-8)32(39)16-23(42-30(38)34-32)19(4)28-31(25,5)44-28/h9-11,13-14,17,19,23-25,28,39H,12,15-16H2,1-8H3,(H,34,38)/b11-9+,18-10+/t19-,23+,24-,25+,28+,31+,32+/m1/s1 |
| InChIKey | OPQNCARIZFLNLF-JBHFWYGFSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ansamitocin P3 (CHEBI:29515) has role antimicrobial agent (CHEBI:33281) |
| ansamitocin P3 (CHEBI:29515) has role antineoplastic agent (CHEBI:35610) |
| ansamitocin P3 (CHEBI:29515) has role metabolite (CHEBI:25212) |
| ansamitocin P3 (CHEBI:29515) is a aromatic ether (CHEBI:35618) |
| ansamitocin P3 (CHEBI:29515) is a carbamate ester (CHEBI:23003) |
| ansamitocin P3 (CHEBI:29515) is a carboxylic ester (CHEBI:33308) |
| ansamitocin P3 (CHEBI:29515) is a epoxide (CHEBI:32955) |
| ansamitocin P3 (CHEBI:29515) is a lactam (CHEBI:24995) |
| ansamitocin P3 (CHEBI:29515) is a macrocycle (CHEBI:51026) |
| ansamitocin P3 (CHEBI:29515) is a monochlorobenzenes (CHEBI:83403) |
| ansamitocin P3 (CHEBI:29515) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-21-hydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-8,23-dioxo-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10(26),11,13,16,18-pentaen-6-yl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| 2'-De(acetylmethylamino)-2'-methylmaytansine | KEGG COMPOUND |
| ansamitocin P-3 | ChEBI |
| Antibiotic C15003P3 | KEGG COMPOUND |
| C15003P3 | KEGG COMPOUND |
| Maytansinol isobutyrate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00018269 | KNApSAcK |
| C12045 | KEGG COMPOUND |
| LMPK04000039 | LIPID MAPS |
| US2007135629 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5416580 | Reaxys |
| CAS:66584-72-3 | KEGG COMPOUND |
| CAS:66584-72-3 | ChemIDplus |
| Citations |
|---|