EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1cc(O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,8H2,(H,10,11) |
| InChIKey | QPEJHSFTZVMSJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-5-hydroxybenzoic acid (CHEBI:29507) is a aminobenzoic acid (CHEBI:22495) |
| 3-amino-5-hydroxybenzoic acid (CHEBI:29507) is a monohydroxybenzoic acid (CHEBI:25389) |
| 3-amino-5-hydroxybenzoic acid (CHEBI:29507) is conjugate acid of 3-amino-5-hydroxybenzoate (CHEBI:71959) |
| Incoming Relation(s) |
| 3-amino-5-hydroxybenzoate (CHEBI:71959) is conjugate base of 3-amino-5-hydroxybenzoic acid (CHEBI:29507) |
| IUPAC Name |
|---|
| 3-amino-5-hydroxybenzoic acid |
| Synonyms | Source |
|---|---|
| 3-Ahba | KEGG COMPOUND |
| 3-Amino-5-hydroxybenzoic acid | KEGG COMPOUND |
| AHBA | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3030568 | Reaxys |
| CAS:76045-71-1 | ChemIDplus |
| CAS:76045-71-1 | KEGG COMPOUND |
| Citations |
|---|