EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| ChEBI ID | CHEBI:29506 |
| ChEBI Name | cethromycin |
| Stars | |
| Definition | A macrolide antibiotic which displays in vitro activity against both gram-positive and gram-negative bacteria and is currently under investigation for the treatment of community-acquired pneumonia. The US Food and Drug Administration (FDA) have also granted orphan drug designation to cethromycin for the treatment of anthrax prophylaxis, tularemia, and plague (PDB entry: 1NWX). |
| Secondary ChEBI ID | CHEBI:40317 |
| Last Modified | 13 September 2019 |
| Downloads |
| Formula | C42H59N3O10 |
| Net Charge | 0 |
| Average Mass | 765.945 |
| Monoisotopic Mass | 765.42005 |
| SMILES | [H]C(CO[C@]1(C)C[C@@H](C)C(=O)[C@H](C)[C@H]2NC(=O)O[C@]2(C)[C@@H](CC)OC(=O)[C@H](C)C(=O)[C@H](C)[C@H]1O[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1O)=C([H])c1cnc2ccccc2c1 |
| InChI | InChI=1S/C42H59N3O10/c1-11-32-42(8)36(44-40(50)55-42)25(4)33(46)23(2)21-41(7,51-18-14-15-28-20-29-16-12-13-17-30(29)43-22-28)37(26(5)34(47)27(6)38(49)53-32)54-39-35(48)31(45(9)10)19-24(3)52-39/h12-17,20,22-27,31-32,35-37,39,48H,11,18-19,21H2,1-10H3,(H,44,50)/t23-,24-,25+,26+,27-,31+,32-,35-,36-,37-,39+,41-,42-/m1/s1 |
| InChIKey | PENDGIOBPJLVBT-AMXFZXBBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cethromycin (CHEBI:29506) has role antibacterial drug (CHEBI:36047) |
| cethromycin (CHEBI:29506) has role protein synthesis inhibitor (CHEBI:48001) |
| cethromycin (CHEBI:29506) is a macrolide antibiotic (CHEBI:25105) |
| cethromycin (CHEBI:29506) is a monosaccharide derivative (CHEBI:63367) |
| cethromycin (CHEBI:29506) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| (3aS,4R,7R,9R,10R,11R,13R,15R,15aR)-4-ethyl-3a,7,9,11,13,15-hexamethyl-2,6,8,14-tetraoxo-11-{[3-(quinolin-3-yl)prop-2-en-1-yl]oxy}tetradecahydro-2H-oxacyclotetradecino[4,3-d][1,3]oxazol-10-yl 3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside |
| INNs | Source |
|---|---|
| cethromycin | WHO MedNet |
| céthromycine | WHO MedNet |
| cethromycinum | WHO MedNet |
| cetromicina | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-195773 | KEGG COMPOUND |
| Abbott-195773 | KEGG COMPOUND |
| ABT-773 | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Restanza | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 773 | PDBeChem |
| C12020 | KEGG COMPOUND |
| Cethromycin | Wikipedia |
| D02391 | KEGG DRUG |
| DB06419 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:205110-48-1 | KEGG COMPOUND |
| CAS:205110-48-1 | ChemIDplus |
| Citations |
|---|