EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H53NO8 |
| Net Charge | 0 |
| Average Mass | 567.764 |
| Monoisotopic Mass | 567.37712 |
| SMILES | CC[C@H]1C[C@@H](C)C(=O)/C=C/C(C)=C/[C@H](C)[C@@H](CC)OC(=O)C[C@@H](O)[C@H](C)[C@H]1O[C@@H]1O[C@H](C)[C@@H](O)[C@H](N(C)C)[C@H]1O |
| InChI | InChI=1S/C31H53NO8/c1-10-22-15-18(4)23(33)13-12-17(3)14-19(5)25(11-2)39-26(35)16-24(34)20(6)30(22)40-31-29(37)27(32(8)9)28(36)21(7)38-31/h12-14,18-22,24-25,27-31,34,36-37H,10-11,15-16H2,1-9H3/b13-12+,17-14+/t18-,19+,20+,21-,22+,24-,25-,27+,28-,29-,30-,31+/m1/s1 |
| InChIKey | BMKVJAXXBOWJEE-BPFVPZITSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) has functional parent tylactone (CHEBI:29700) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) has role metabolite (CHEBI:25212) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) is a enone (CHEBI:51689) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) is a macrolide antibiotic (CHEBI:25105) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) is a monosaccharide derivative (CHEBI:63367) |
| 5-O-β-D-mycaminosyltylactone (CHEBI:29491) is conjugate base of 5-O-β-D-mycaminosyltylactone(1+) (CHEBI:76802) |
| Incoming Relation(s) |
| 5-O-β-D-mycaminosyltylactone(1+) (CHEBI:76802) is conjugate acid of 5-O-β-D-mycaminosyltylactone (CHEBI:29491) |
| IUPAC Name |
|---|
| (4R,5S,6S,7S,9R,11E,13E,15S,16R)-7,16-diethyl-4-hydroxy-5,9,13,15-tetramethyl-2,10-dioxooxacyclohexadeca-11,13-dien-6-yl 3,6-dideoxy-3-(dimethylamino)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 20-deoxo-23-deoxy-5-O-(3,6-dideoxy-3-(dimethylamino)-beta-D-glucopyranosyl)-tylonolide | ChemIDplus |
| 5-Mcpt | ChemIDplus |
| 5-O-beta-D-Mycaminosyltylactone | KEGG COMPOUND |
| 5-O-Mycaminosylprotylonolide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12001 | KEGG COMPOUND |
| WO2005054265 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6454572 | Reaxys |
| CAS:81661-90-7 | ChemIDplus |
| Citations |
|---|