EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.349 |
| Monoisotopic Mass | 259.15723 |
| SMILES | CCCCCCCc1nc2ccccc2c(=O)c1O |
| InChI | InChI=1S/C16H21NO2/c1-2-3-4-5-6-11-14-16(19)15(18)12-9-7-8-10-13(12)17-14/h7-10,19H,2-6,11H2,1H3,(H,17,18) |
| InChIKey | CEIUIHOQDSVZJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-heptyl-3-hydroxy-4-quinolone (CHEBI:29472) has role signalling molecule (CHEBI:62488) |
| 2-heptyl-3-hydroxy-4-quinolone (CHEBI:29472) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 2-heptyl-3-hydroxyquinolin-4(1H)-one |
| Synonyms | Source |
|---|---|
| 2-heptyl-3-hydroxy-4(1H)-quinolone | ChEBI |
| 2-heptyl-3-hydroxy-quinolone | MetaCyc |
| 2-Heptyl-3-hydroxy-quinolone | KEGG COMPOUND |
| Pseudomonas quinolone signal | MetaCyc |
| PQS | MetaCyc |
| UniProt Name | Source |
|---|---|
| 2-heptyl-3-hydroxy-4(1H)-quinolone | UniProt |
| Citations |
|---|