EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O5 |
| Net Charge | 0 |
| Average Mass | 234.252 |
| Monoisotopic Mass | 234.12157 |
| SMILES | NC(CCCC(N)C(O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H18N2O5/c10-5(7(12)4-8(13)14)2-1-3-6(11)9(15)16/h5-7,12H,1-4,10-11H2,(H,13,14)(H,15,16) |
| InChIKey | XMYUTJGBCFJNFF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) has role plant metabolite (CHEBI:76924) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) is a diamino acid (CHEBI:35987) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 2,6-diamino-7-hydroxy-azelaic acid (CHEBI:29468) is a γ-amino acid (CHEBI:33707) |
| IUPAC Name |
|---|
| 2,6-diamino-7-hydroxynonanedioic acid |
| Synonym | Source |
|---|---|
| 2,6-Diamino-7-hydroxy-azelaic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12025 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1971766 | Reaxys |