EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17NO3 |
| Net Charge | 0 |
| Average Mass | 187.239 |
| Monoisotopic Mass | 187.12084 |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H17NO3/c1-3-4-5-6(2)8(11)7(10)9(12)13/h3-4,6-8,11H,5,10H2,1-2H3,(H,12,13)/b4-3+/t6-,7+,8-/m1/s1 |
| InChIKey | RPALEGQGCGCFCX-FIWMUJSFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-Butenyl-4-methyl-threonine (CHEBI:29458) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonyms | Source |
|---|---|
| 2-Butenyl-4-methylthreonine | KEGG COMPOUND |
| (E)-2-Butenyl-4-methyl-threonine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C12029 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:81135-57-1 | KEGG COMPOUND |