EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O10 |
| Net Charge | 0 |
| Average Mass | 450.440 |
| Monoisotopic Mass | 450.15260 |
| SMILES | COc1c(O)cc([C@@H]2CCc3ccc(O)cc3O2)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26O10/c1-29-21-13(25)6-11(14-5-3-10-2-4-12(24)8-15(10)30-14)7-16(21)31-22-20(28)19(27)18(26)17(9-23)32-22/h2,4,6-8,14,17-20,22-28H,3,5,9H2,1H3/t14-,17+,18+,19-,20+,22+/m0/s1 |
| InChIKey | IJMWYFHXJWRHQH-PSWNVJQFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia auriculiformis (ncbitaxon:205027) | - | DOI (10.1016/0031-9422(80)80226-3) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auriculoside (CHEBI:2929) has functional parent (2S)-flavan (CHEBI:36103) |
| auriculoside (CHEBI:2929) has role plant metabolite (CHEBI:76924) |
| auriculoside (CHEBI:2929) is a flavan glycoside (CHEBI:85938) |
| auriculoside (CHEBI:2929) is a hydroxyflavan (CHEBI:72010) |
| auriculoside (CHEBI:2929) is a methoxyflavan (CHEBI:72585) |
| auriculoside (CHEBI:2929) is a monosaccharide derivative (CHEBI:63367) |
| auriculoside (CHEBI:2929) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(2S)-7-hydroxy-3,4-dihydro-2H-1-benzopyran-2-yl]-2-methoxyphenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 7,3',5'-Trihydroxy-4'-methoxyflavan 3'-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008764 | KNApSAcK |
| C09478 | KEGG COMPOUND |
| LMPK12020249 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5664400 | Reaxys |
| CAS:75871-96-4 | KEGG COMPOUND |