EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HNO4 |
| Net Charge | 0 |
| Average Mass | 79.011 |
| Monoisotopic Mass | 78.99056 |
| SMILES | [H]OON(=O)=O |
| InChI | InChI=1S/HNO4/c2-1(3)5-4/h4H |
| InChIKey | UUZZMWZGAZGXSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peroxynitric acid (CHEBI:29271) is a nitrogen oxoacid (CHEBI:33455) |
| peroxynitric acid (CHEBI:29271) is conjugate acid of peroxynitrate (CHEBI:29270) |
| Incoming Relation(s) |
| peroxynitrate (CHEBI:29270) is conjugate base of peroxynitric acid (CHEBI:29271) |
| IUPAC Names |
|---|
| (dioxidanido)dioxidonitrogen |
| azoperoxoic acid |
| peroxynitric acid |
| Synonyms | Source |
|---|---|
| HNO4 | IUPAC |
| [NO2(OOH)] | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:49370 | Gmelin |
| CAS:26404-66-0 | NIST Chemistry WebBook |
| CAS:26404-66-0 | ChemIDplus |