EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O3Se |
| Net Charge | 0 |
| Average Mass | 128.973 |
| Monoisotopic Mass | 129.91692 |
| SMILES | [H]O[Se]([H])(=O)=O |
| InChI | InChI=1S/H2O3Se/c1-4(2)3/h4H,(H,1,2,3) |
| InChIKey | WBRSXICUEVGXAB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenonic acid (CHEBI:29217) is a selenium oxoacid (CHEBI:33489) |
| Incoming Relation(s) |
| selenono group (CHEBI:29923) is substituent group from selenonic acid (CHEBI:29217) |
| IUPAC Names |
|---|
| hydridohydroxidodioxidoselenium |
| selenonic acid |
| Synonym | Source |
|---|---|
| [SeHO2(OH)] | IUPAC |