EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O7S2 |
| Net Charge | 0 |
| Average Mass | 178.143 |
| Monoisotopic Mass | 177.92419 |
| SMILES | [H]OS(=O)(=O)OS(=O)(=O)O[H] |
| InChI | InChI=1S/H2O7S2/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6) |
| InChIKey | VFNGKCDDZUSWLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disulfuric acid (CHEBI:29211) is a sulfur oxoacid (CHEBI:33402) |
| IUPAC Names |
|---|
| disulfuric acid |
| μ-oxido-bis(hydroxidodioxidosulfur) |
| Synonyms | Source |
|---|---|
| disulphuric acid | ChEBI |
| [(HO)S(O)2OS(O)2(OH)] | IUPAC |
| H2S2O7 | IUPAC |
| Pyrosulfuric acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:7783-05-3 | ChemIDplus |