EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29208 - dithionic acid
| Formula | H2O6S2 |
| Net Charge | 0 |
| Average Mass | 162.144 |
| Monoisotopic Mass | 161.92928 |
| SMILES | [H]OS(=O)(=O)S(=O)(=O)O[H] |
| InChI | InChI=1S/H2O6S2/c1-7(2,3)8(4,5)6/h(H,1,2,3)(H,4,5,6) |
| InChIKey | RMGVZKRVHHSUIM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dithionic acid (CHEBI:29208) is a sulfur oxoacid (CHEBI:33402) |
| dithionic acid (CHEBI:29208) is conjugate acid of dithionate(1−) (CHEBI:33486) |
| Incoming Relation(s) |
| dithionate(1−) (CHEBI:33486) is conjugate base of dithionic acid (CHEBI:29208) |
| IUPAC Names |
|---|
| 1,4-dihydrido-2,2,3,3-tetraoxido-1,4-dioxy-2,3-disulfy-[4]catena |
| bis(hydroxidodioxidosulfur)(S—S) |
| dithionic acid |
| Synonyms | Source |
|---|---|
| [(HO)(O)2SS(O)2(OH)] | IUPAC |
| H2S2O6 | IUPAC |
| hypodisulfuric acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:82514 | Gmelin |
| CAS:14970-71-9 | ChemIDplus |