EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H4O5P2 |
| Net Charge | 0 |
| Average Mass | 145.975 |
| Monoisotopic Mass | 145.95340 |
| SMILES | [H]P(=O)(O)OP([H])(=O)O |
| InChI | InChI=1S/H4O5P2/c1-6(2)5-7(3)4/h6-7H,(H,1,2)(H,3,4) |
| InChIKey | XQRLCLUYWUNEEH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphosphonic acid (CHEBI:29205) is a acyclic phosphorus acid anhydride (CHEBI:37786) |
| diphosphonic acid (CHEBI:29205) is a phosphorus oxoacid (CHEBI:33457) |
| diphosphonic acid (CHEBI:29205) is conjugate acid of diphosphonate(1−) (CHEBI:33463) |
| Incoming Relation(s) |
| diphosphonate(1−) (CHEBI:33463) is conjugate base of diphosphonic acid (CHEBI:29205) |
| IUPAC Names |
|---|
| diphosphonic acid |
| μ-oxido-bis(hydridohydroxidooxidophosphorus) |
| Synonyms | Source |
|---|---|
| H2P2H2O5 | IUPAC |
| [(OH)P(H)(O)OP(H)(O)(OH)] | IUPAC |
| pyrophosphonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Gmelin:82148 | Gmelin |
| CAS:36465-90-4 | ChemIDplus |