EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H5O10P3 |
| Net Charge | 0 |
| Average Mass | 257.952 |
| Monoisotopic Mass | 257.90956 |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6) |
| InChIKey | UNXRWKVEANCORM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphosphoric acid (CHEBI:39949) is a acyclic phosphorus acid anhydride (CHEBI:37786) |
| triphosphoric acid (CHEBI:39949) is a phosphorus oxoacid (CHEBI:33457) |
| triphosphoric acid (CHEBI:39949) is conjugate acid of triphosphate(1−) (CHEBI:48313) |
| Incoming Relation(s) |
| triphosphate(1−) (CHEBI:48313) is conjugate base of triphosphoric acid (CHEBI:39949) |
| triphosphate group (CHEBI:32959) is substituent group from triphosphoric acid (CHEBI:39949) |
| IUPAC Names |
|---|
| 1,7-dihydrido-2,4,6-trihydroxido-2,4,6-trioxido-1,3,5,7-tetraoxy-2,4,6-triphosphy-[7]catena |
| bis(dihydroxidodioxidophosphato)hydroxidooxidophosphorus |
| pentahydroxido-1κ2O,2κO,3κ2O-di-μ-oxido-trioxido-1κO,2κO,3κO-triphosphorus |
| μ-[hydroxidotrioxidophosphato(2−)-1κO,2κO]-bis(dihydroxidooxidophosphorus) |
| Synonyms | Source |
|---|---|
| acide triphosphorique | ChEBI |
| catena-triphosphoric acid | IUPAC |
| H5P3O10 | IUPAC |
| Inorganic triphosphate | KEGG COMPOUND |
| TRIPHOSPHATE | PDBeChem |
| Triphosphoric acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3PO | PDBeChem |
| C00536 | KEGG COMPOUND |
| DB03896 | DrugBank |
| FDB028913 | FooDB |
| HMDB0003379 | HMDB |
| Triphosphoric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:185379 | Gmelin |
| CAS:10380-08-2 | ChemIDplus |