EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5N3O |
| Net Charge | 0 |
| Average Mass | 135.126 |
| Monoisotopic Mass | 135.04326 |
| SMILES | O=c1nccc2nccn12 |
| InChI | InChI=1S/C6H5N3O/c10-6-8-2-1-5-7-3-4-9(5)6/h1-4H,(H,8,10) |
| InChIKey | GICKXGZWALFYHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,N4-ethenocytosine (CHEBI:29147) has functional parent cytosine (CHEBI:16040) |
| 3,N4-ethenocytosine (CHEBI:29147) has parent hydride imidazo[1,2-c]pyrimidine (CHEBI:35874) |
| 3,N4-ethenocytosine (CHEBI:29147) has role mutagen (CHEBI:25435) |
| 3,N4-ethenocytosine (CHEBI:29147) is a organic heterobicyclic compound (CHEBI:27171) |
| IUPAC Name |
|---|
| imidazo[1,2-c]pyrimidin-5(6H)-one |
| Synonyms | Source |
|---|---|
| 3,N(4)-Ethanocytosine | ChemIDplus |
| ethenocytosine | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,N4-ethenocytosine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:607434 | Beilstein |
| CAS:55662-66-3 | ChemIDplus |