EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5N5 |
| Net Charge | 0 |
| Average Mass | 159.152 |
| Monoisotopic Mass | 159.05450 |
| SMILES | c1nc2ncn3ccnc3c2n1 |
| InChI | InChI=1S/C7H5N5/c1-2-12-4-11-6-5(7(12)8-1)9-3-10-6/h1-4H,(H,9,10) |
| InChIKey | OGVOXGPIHFKUGM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-imidazo[2,1-i]purine (CHEBI:29146) has functional parent adenine (CHEBI:16708) |
| 1H-imidazo[2,1-i]purine (CHEBI:29146) has role mutagen (CHEBI:25435) |
| 1H-imidazo[2,1-i]purine (CHEBI:29146) is a imidazo[2,1-i]purine (CHEBI:36690) |
| 1H-imidazo[2,1-i]purine (CHEBI:29146) is tautomer of 3H-imidazo[2,1-i]purine (CHEBI:42173) |
| Incoming Relation(s) |
| 3H-imidazo[2,1-i]purine (CHEBI:42173) is tautomer of 1H-imidazo[2,1-i]purine (CHEBI:29146) |
| IUPAC Name |
|---|
| 1H-imidazo[2,1-i]purine |
| Synonyms | Source |
|---|---|
| 1,N6-ethenoadenine | ChemIDplus |
| ethenoadenine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB01952 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:13875-63-3 | ChemIDplus |