EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52N7O17P3S |
| Net Charge | 0 |
| Average Mass | 919.778 |
| Monoisotopic Mass | 919.23532 |
| SMILES | CCCCCC/C=C/CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C31H52N7O17P3S/c1-4-5-6-7-8-9-10-11-22(40)59-15-14-33-21(39)12-13-34-29(43)26(42)31(2,3)17-52-58(49,50)55-57(47,48)51-16-20-25(54-56(44,45)46)24(41)30(53-20)38-19-37-23-27(32)35-18-36-28(23)38/h9-10,18-20,24-26,30,41-42H,4-8,11-17H2,1-3H3,(H,33,39)(H,34,43)(H,47,48)(H,49,50)(H2,32,35,36)(H2,44,45,46)/b10-9+/t20-,24-,25-,26+,30-/m1/s1 |
| InChIKey | CQGVNMQHZQJNII-ZJZQAHHTSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-dec-3-enoyl-CoA (CHEBI:29126) has functional parent trans-dec-3-enoic acid (CHEBI:37809) |
| trans-dec-3-enoyl-CoA (CHEBI:29126) is a trans-3-enoyl-CoA (CHEBI:27700) |
| trans-dec-3-enoyl-CoA (CHEBI:29126) is a medium-chain fatty acyl-CoA (CHEBI:61907) |
| trans-dec-3-enoyl-CoA (CHEBI:29126) is a monounsaturated fatty acyl-CoA (CHEBI:139575) |
| trans-dec-3-enoyl-CoA (CHEBI:29126) is conjugate acid of trans-dec-3-enoyl-CoA(4−) (CHEBI:84793) |
| Incoming Relation(s) |
| trans-dec-3-enoyl-CoA(4−) (CHEBI:84793) is conjugate base of trans-dec-3-enoyl-CoA (CHEBI:29126) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-({3-[(2-{[(3E)-dec-3-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-trans-decenoyl-CoA | ChEBI |
| 3-trans-decenoyl-coenzyme A | ChEBI |
| trans-3-decenoyl-CoA | ChEBI |
| trans-3-decenoyl-coenzyme A | ChEBI |
| trans-dec-3-enoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002137 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11165738 | Reaxys |