EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N5O8P |
| Net Charge | 0 |
| Average Mass | 353.228 |
| Monoisotopic Mass | 353.07365 |
| SMILES | Nc1nc(O)c(N)c(N[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C9H16N5O8P/c10-3-6(13-9(11)14-7(3)17)12-8-5(16)4(15)2(22-8)1-21-23(18,19)20/h2,4-5,8,15-16H,1,10H2,(H2,18,19,20)(H4,11,12,13,14,17)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | OCLCLRXKNJCOJD-UMMCILCDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) is a N-glycosyl compound (CHEBI:21731) |
| 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) is a aminopyrimidine (CHEBI:38338) |
| 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) is a hydroxypyrimidine (CHEBI:38340) |
| 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) is a ribose monophosphate (CHEBI:35159) |
| 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) is conjugate acid of 2,5-diamino-4-hydroxy-6-(5-phosphonatoribosylamino)pyrimidine(2−) (CHEBI:58614) |
| Incoming Relation(s) |
| 2,5-diamino-4-hydroxy-6-(5-phosphonatoribosylamino)pyrimidine(2−) (CHEBI:58614) is conjugate base of 2,5-diamino-4-hydroxy-6-(5-phosphoribosylamino)pyrimidine (CHEBI:29114) |
| IUPAC Name |
|---|
| 1-deoxy-1-[(2,5-diamino-6-hydroxypyrimidin-3-yl)amino]-β-D-ribofuranose 5-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 2,5-Diamino-6-hydroxy-4-(5'-phosphoribosylamino)-pyrimidine | KEGG COMPOUND |
| 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine | ChEBI |
| N-(2,5-diamino-6-hydroxypyrimidin-4-yl)-5-O-phosphono-β-D-ribofuranosylamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01304 | KEGG COMPOUND |