EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO3 |
| Net Charge | 0 |
| Average Mass | 293.407 |
| Monoisotopic Mass | 293.19909 |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1CCCC2O |
| InChI | InChI=1S/C17H27NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,15,18-20H,4,7-8,10-11H2,1-3H3 |
| InChIKey | LGXDICLRWHYEIS-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (±)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol (CHEBI:29109) is a naphthols (CHEBI:25392) |
| (±)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol (CHEBI:29109) is conjugate base of (±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol(1+) (CHEBI:58611) |
| Incoming Relation(s) |
| (±)-5-[3-(tert-butylammonio)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol(1+) (CHEBI:58611) is conjugate acid of (±)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol (CHEBI:29109) |
| IUPAC Name |
|---|
| 5-[rac-3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
| Synonyms | Source |
|---|---|
| (+/-)-5-[(tert-Butylamino)-2'-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol | KEGG COMPOUND |
| (+/-)-5-[(tert-butylaminol)-2'-hydroxypropoxy]-1,2,3,4-tetrahydro-1-naphthol | ChEBI |
| (+/-)-Dihydrobunolol | KEGG COMPOUND |
| Dihydrobunolol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C04875 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:38947-37-4 | ChemIDplus |