EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | COc1cc(O)c2c(=O)c3cc(O)c(O)cc3oc2c1 |
| InChI | InChI=1S/C14H10O6/c1-19-6-2-10(17)13-12(3-6)20-11-5-9(16)8(15)4-7(11)14(13)18/h2-5,15-17H,1H3 |
| InChIKey | IFNAQIAMTNJLIF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| athyriol (CHEBI:2908) has role plant metabolite (CHEBI:76924) |
| athyriol (CHEBI:2908) is a aromatic ether (CHEBI:35618) |
| athyriol (CHEBI:2908) is a polyphenol (CHEBI:26195) |
| athyriol (CHEBI:2908) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,6,7-trihydroxy-3-methoxy-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 3-Methoxy-1,6,7-trihydroxyxanthone | KEGG COMPOUND |