EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O9S2 |
| Net Charge | 0 |
| Average Mass | 448.475 |
| Monoisotopic Mass | 448.06102 |
| SMILES | O=S(=O)(O)ON=C(Cc1cnc2ccccc12)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20N2O9S2/c19-7-11-13(20)14(21)15(22)16(26-11)28-12(18-27-29(23,24)25)5-8-6-17-10-4-2-1-3-9(8)10/h1-4,6,11,13-17,19-22H,5,7H2,(H,23,24,25)/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | DNDNWOWHUWNBCK-JZYAIQKZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucobrassicin (CHEBI:29028) is a indolyl carbohydrate (CHEBI:24821) |
| glucobrassicin (CHEBI:29028) is a indolylmethylglucosinolic acid (CHEBI:79364) |
| glucobrassicin (CHEBI:29028) is conjugate acid of glucobrassicin(1−) (CHEBI:64962) |
| Incoming Relation(s) |
| 4-hydroxyglucobrassicin (CHEBI:1865) has functional parent glucobrassicin (CHEBI:29028) |
| 4-methoxyglucobrassicin (CHEBI:1890) has functional parent glucobrassicin (CHEBI:29028) |
| neoglucobrassicin (CHEBI:27506) has functional parent glucobrassicin (CHEBI:29028) |
| sulfoglucobrassicin (CHEBI:27842) has functional parent glucobrassicin (CHEBI:29028) |
| glucobrassicin(1−) (CHEBI:64962) is conjugate base of glucobrassicin (CHEBI:29028) |
| IUPAC Name |
|---|
| 1-S-[2-(1H-indol-3-yl)-N-(sulfooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 3-IMG | ChemIDplus |
| 3-Indolylmethyl glucosinolate | ChemIDplus |
| 3-Indolylmethylglucosinolate | ChemIDplus |
| Glucobrassicin | KEGG COMPOUND |
| indol-3-ylmethylglucosinolate | ChEBI |
| Indolylmethyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000125 | KNApSAcK |
| C05837 | KEGG COMPOUND |
| CPD-1863 | MetaCyc |
| Glucobrassicin | Wikipedia |
| HMDB0030243 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:504069 | Reaxys |
| CAS:4356-52-9 | ChemIDplus |
| CAS:4356-52-9 | KEGG COMPOUND |
| Citations |
|---|