EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N4O6 |
| Net Charge | 0 |
| Average Mass | 592.737 |
| Monoisotopic Mass | 592.32609 |
| SMILES | CCC1=C(C)C(Cc2nc(Cc3nc(CC4NC(=O)C(C)=C4CC)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O |
| InChI | InChI=1S/C33H44N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h26-27,34-35H,7-15H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41) |
| InChIKey | OBHRVMZSZIDDEK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| urobilinogen (CHEBI:29026) has role human metabolite (CHEBI:77746) |
| urobilinogen (CHEBI:29026) is a bilanes (CHEBI:22866) |
| urobilinogen (CHEBI:29026) is conjugate acid of urobilinogen(2−) (CHEBI:228218) |
| Incoming Relation(s) |
| urobilinogen(2−) (CHEBI:228218) is conjugate base of urobilinogen (CHEBI:29026) |
| IUPAC Name |
|---|
| 2,17-diethyl-3,7,13,18-tetramethyl-1,19-dioxo-1,4,5,10,15,16,19,22,23,24-decahydro-21H-biline-8,12-dipropanoic acid |
| Synonyms | Source |
|---|---|
| 2,17-diethyl-1,4,5,10,15,16,19,22,23,24-decahydro-3,7,13,18-tetramethyl-1,19-dioxo-21H-biline-8,12-dipropanoic acid | ChemIDplus |
| 8,12-bis(2-carboxyethyl)-3,18-diethyl-2,7,13,17-tetramethylbilane-1,19(4H,16H)-dione | JCBN |
| I-Urobilinogen | KEGG COMPOUND |
| Mesobilirubinogen | KEGG COMPOUND |
| mesobilirubinogen IXα | JCBN |
| Urobilinogen | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05790 | KEGG COMPOUND |
| HMDB0004158 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:75461 | Reaxys |
| CAS:14684-37-8 | KEGG COMPOUND |
| CAS:14684-37-8 | ChemIDplus |
| Citations |
|---|