EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(C)C(=O)CC(=O)O |
| InChI | InChI=1S/C6H10O3/c1-4(2)5(7)3-6(8)9/h4H,3H2,1-2H3,(H,8,9) |
| InChIKey | ZXLSKTZECNUVIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-3-oxopentanoic acid (CHEBI:29024) has functional parent valeric acid (CHEBI:17418) |
| 4-methyl-3-oxopentanoic acid (CHEBI:29024) is a 3-oxo fatty acid (CHEBI:134416) |
| 4-methyl-3-oxopentanoic acid (CHEBI:29024) is a branched-chain fatty acid (CHEBI:35819) |
| 4-methyl-3-oxopentanoic acid (CHEBI:29024) is conjugate acid of 4-methyl-3-oxopentanoate (CHEBI:62222) |
| Incoming Relation(s) |
| 4-methyl-3-oxopentanoate (CHEBI:62222) is conjugate base of 4-methyl-3-oxopentanoic acid (CHEBI:29024) |
| IUPAC Name |
|---|
| 4-methyl-3-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 3-Oxo-4-methylpentanoic acid | KEGG COMPOUND |
| beta-Ketoisocaproic acid | KEGG COMPOUND |
| beta-Ketoisocaproate | KEGG COMPOUND |
| β-oxo-4-methylcaproic aicd | ChEBI |
| β-oxo-4-methylpentanoic aicd | ChEBI |
| 3-Oxo-4-methylpentanoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03467 | KEGG COMPOUND |
| LMFA01020276 | LIPID MAPS |