EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11NO2 |
| Net Charge | 0 |
| Average Mass | 201.225 |
| Monoisotopic Mass | 201.07898 |
| SMILES | Nc1ccccc1-c1cccc(O)c1O |
| InChI | InChI=1S/C12H11NO2/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15/h1-7,14-15H,13H2 |
| InChIKey | WPDDFIBFWKUENN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-aminobiphenyl-2,3-diol (CHEBI:29010) has functional parent biphenyl-2,3-diol (CHEBI:16205) |
| 2'-aminobiphenyl-2,3-diol (CHEBI:29010) has role mouse metabolite (CHEBI:75771) |
| 2'-aminobiphenyl-2,3-diol (CHEBI:29010) is a aminobiphenyl (CHEBI:22496) |
| IUPAC Name |
|---|
| 2'-amino-[1,1'-biphenyl]-2,3-diol |
| Synonym | Source |
|---|---|
| 2'-Aminobiphenyl-2,3-diol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2'-aminobiphenyl-2,3-diol | UniProt |