EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3 |
| Net Charge | 0 |
| Average Mass | 125.175 |
| Monoisotopic Mass | 125.09530 |
| SMILES | Cn1cnc(CCN)c1 |
| InChI | InChI=1S/C6H11N3/c1-9-4-6(2-3-7)8-5-9/h4-5H,2-3,7H2,1H3 |
| InChIKey | FHQDWPCFSJMNCT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nτ-methylhistamine (CHEBI:29009) has functional parent histamine (CHEBI:18295) |
| Nτ-methylhistamine (CHEBI:29009) has role human metabolite (CHEBI:77746) |
| Nτ-methylhistamine (CHEBI:29009) has role mouse metabolite (CHEBI:75771) |
| Nτ-methylhistamine (CHEBI:29009) is a imidazoles (CHEBI:24780) |
| Nτ-methylhistamine (CHEBI:29009) is a primary amino compound (CHEBI:50994) |
| Nτ-methylhistamine (CHEBI:29009) is conjugate base of Nτ-methylhistaminium (CHEBI:58600) |
| Incoming Relation(s) |
| Nτ-methylhistaminium (CHEBI:58600) is conjugate acid of Nτ-methylhistamine (CHEBI:29009) |
| IUPAC Name |
|---|
| 2-(1-methyl-1H-imidazol-4-yl)ethanamine |
| Synonyms | Source |
|---|---|
| 1-methyl-1H-imidazole-4-ethanamine | ChemIDplus |
| 1-Methyl-4-(2-aminoethyl)imidazole | KEGG COMPOUND |
| 1-Methylhistamine | KEGG COMPOUND |
| 3-Methylhistamine | HMDB |
| 4-(1-aminoethyl)-1-methyl-1H-imidazole | ChemIDplus |
| N1-methylhistamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05127 | KEGG COMPOUND |
| HMDB0001861 | HMDB |
| N-METHYL-HISTAMINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:110757 | Reaxys |
| Gmelin:2906 | Gmelin |
| CAS:501-75-7 | ChemIDplus |
| CAS:501-75-7 | KEGG COMPOUND |
| Citations |
|---|