EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N4O4 |
| Net Charge | 0 |
| Average Mass | 252.230 |
| Monoisotopic Mass | 252.08585 |
| SMILES | O=c1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12N4O4/c15-2-6-5(16)1-7(18-6)14-4-13-8-9(14)11-3-12-10(8)17/h3-7,15-16H,1-2H2,(H,11,12,17)/t5-,6+,7+/m0/s1 |
| InChIKey | VGONTNSXDCQUGY-RRKCRQDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-deoxyinosine (CHEBI:28997) has functional parent inosine (CHEBI:17596) |
| 2'-deoxyinosine (CHEBI:28997) has role Escherichia coli metabolite (CHEBI:76971) |
| 2'-deoxyinosine (CHEBI:28997) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2'-deoxyinosine (CHEBI:28997) has role human metabolite (CHEBI:77746) |
| 2'-deoxyinosine (CHEBI:28997) has role mouse metabolite (CHEBI:75771) |
| 2'-deoxyinosine (CHEBI:28997) has role plant metabolite (CHEBI:76924) |
| 2'-deoxyinosine (CHEBI:28997) is a purine 2'-deoxyribonucleoside (CHEBI:19254) |
| 2'-deoxyinosine (CHEBI:28997) is a purines 2'-deoxy-D-ribonucleoside (CHEBI:142361) |
| IUPAC Names |
|---|
| 2'-deoxyinosine |
| 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-9H-purin-6-ol |
| Synonyms | Source |
|---|---|
| 9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purin-6-ol | IUPAC |
| Deoxyinosine | KEGG COMPOUND |
| Deoxyinosine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2'-deoxyinosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05512 | KEGG COMPOUND |
| DB02380 | DrugBank |
| DEOXYINOSINE | MetaCyc |
| HMDB0000071 | HMDB |
| YMDB00659 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1011821 | Reaxys |
| CAS:890-38-0 | ChemIDplus |
| CAS:890-38-0 | KEGG COMPOUND |
| Citations |
|---|