EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2 |
| Net Charge | 0 |
| Average Mass | 162.236 |
| Monoisotopic Mass | 162.11570 |
| SMILES | c1cncc(C2CCCCN2)c1 |
| InChI | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| InChIKey | MTXSIJUGVMTTMU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anabasine (CHEBI:28986) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| anabasine (CHEBI:28986) has role plant metabolite (CHEBI:76924) |
| anabasine (CHEBI:28986) has role teratogenic agent (CHEBI:50905) |
| anabasine (CHEBI:28986) is a piperidine alkaloid (CHEBI:26147) |
| anabasine (CHEBI:28986) is a pyridine alkaloid (CHEBI:26416) |
| Incoming Relation(s) |
| tetrahydroanabasine(1+) (CHEBI:197286) has functional parent anabasine (CHEBI:28986) |
| (S)-anabasine (CHEBI:74) is a anabasine (CHEBI:28986) |
| IUPAC Name |
|---|
| 3-(piperidin-2-yl)pyridine |
| Synonyms | Source |
|---|---|
| (±)-anabasine | ChemIDplus |
| Anabasine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:82639 | Reaxys |
| CAS:13078-04-1 | KEGG COMPOUND |
| CAS:13078-04-1 | ChemIDplus |
| Citations |
|---|