EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6Cl2O2 |
| Net Charge | 0 |
| Average Mass | 181.018 |
| Monoisotopic Mass | 179.97448 |
| SMILES | OC1C=C(Cl)C(O)C=C1Cl |
| InChI | InChI=1S/C6H6Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,5-6,9-10H |
| InChIKey | CPXFTNFOQXXRBF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphingobium japonicum (ncbitaxon:452662) | - | PubMed (16636477) | Strain: UT26S |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dichloro-2,5-cyclohexadiene-1,4-diol (CHEBI:28975) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,5-dichloro-2,5-cyclohexadiene-1,4-diol (CHEBI:28975) is a cyclohexadienediol (CHEBI:23469) |
| 2,5-dichloro-2,5-cyclohexadiene-1,4-diol (CHEBI:28975) is a organic hydroxy compound (CHEBI:33822) |
| 2,5-dichloro-2,5-cyclohexadiene-1,4-diol (CHEBI:28975) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2,5-dichlorocyclohexa-2,5-diene-1,4-diol |
| Synonyms | Source |
|---|---|
| 2,5-dichloro-2,5-cyclohexadiene-1,4-diol | ChEBI |
| 1,4-dihydroxyl-2,5-dichloro-2,5-cyclohexadiene | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,5-dichlorocyclohexa-2,5-dien-1,4-diol | UniProt |
| Citations |
|---|