EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31FN4O |
| Net Charge | 0 |
| Average Mass | 458.581 |
| Monoisotopic Mass | 458.24819 |
| SMILES | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H31FN4O/c1-34-25-12-8-21(9-13-25)14-17-32-18-15-24(16-19-32)30-28-31-26-4-2-3-5-27(26)33(28)20-22-6-10-23(29)11-7-22/h2-13,24H,14-20H2,1H3,(H,30,31) |
| InChIKey | GXDALQBWZGODGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astemizole (CHEBI:2896) has role anti-allergic agent (CHEBI:50857) |
| astemizole (CHEBI:2896) has role anticoronaviral agent (CHEBI:149553) |
| astemizole (CHEBI:2896) has role H1-receptor antagonist (CHEBI:37955) |
| astemizole (CHEBI:2896) is a benzimidazoles (CHEBI:22715) |
| astemizole (CHEBI:2896) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 1-(4-fluorobenzyl)-N-{1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl}-1H-benzimidazol-2-amine |
| INNs | Source |
|---|---|
| astemizole | KEGG DRUG |
| astemizol | ChemIDplus |
| astemizolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(p-Fluorobenzyl)-2-((1-(2-(p-methoxyphenyl)ethyl)piperid-4-yl)amino)benzimidazole | ChemIDplus |
| 1-(p-Fluorobenzyl)-2-((1-(p-methoxyphenethyl)-4-piperidyl)amino)benzimidazole | ChemIDplus |
| Astemison | ChemIDplus |