EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O4 |
| Net Charge | 0 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04226 |
| SMILES | CC(/C=C\C(=O)O)=C/C(=O)O |
| InChI | InChI=1S/C7H8O4/c1-5(4-7(10)11)2-3-6(8)9/h2-4H,1H3,(H,8,9)(H,10,11)/b3-2-,5-4- |
| InChIKey | LEQDZBVDPGNGMH-LDIADDGTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-cis,cis-muconic acid (CHEBI:28958) has functional parent cis,cis-muconic acid (CHEBI:16508) |
| 3-methyl-cis,cis-muconic acid (CHEBI:28958) is a polyunsaturated dicarboxylic acid (CHEBI:134531) |
| IUPAC Name |
|---|
| (2Z,4Z)-3-methylhexa-2,4-dienedioic acid |
| Synonyms | Source |
|---|---|
| (2Z,4Z)-3-methylmuconic acid | ChEBI |
| 3-methyl-cis,cis-hexadienedioic acid | ChEBI |
| 3-methyl-cis,cis-muconic acid | ChEBI |