EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20NO4 |
| Net Charge | +1 |
| Average Mass | 350.394 |
| Monoisotopic Mass | 350.13868 |
| SMILES | COc1cc2c(ccc3c4cc(OC)c(OC)cc4c[n+](C)c23)cc1O |
| InChI | InChI=1S/C21H19NO4/c1-22-11-13-8-19(25-3)20(26-4)9-15(13)14-6-5-12-7-17(23)18(24-2)10-16(12)21(14)22/h5-11H,1-4H3/p+1 |
| InChIKey | OOKZVPUCASIEBL-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fagaronine (CHEBI:28954) has role mutagen (CHEBI:25435) |
| fagaronine (CHEBI:28954) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 2-hydroxy-3,8,9-trimethoxy-5-methylbenzo[c]phenanthridinium |
| Synonym | Source |
|---|---|
| Fagaronine | KEGG COMPOUND |