EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28951 - (9S,10S)-9,10-dihydrophenanthrene-9,10-diol
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O[C@H]1c2ccccc2-c2ccccc2[C@@H]1O |
| InChI | InChI=1S/C14H12O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8,13-16H/t13-,14-/m0/s1 |
| InChIKey | MFXNBQWUTDDOKE-KBPBESRZSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9S,10S)-9,10-dihydrophenanthrene-9,10-diol (CHEBI:28951) is a trans-9,10-dihydrophenanthrene-9,10-diol (CHEBI:37470) |
| (9S,10S)-9,10-dihydrophenanthrene-9,10-diol (CHEBI:28951) is enantiomer of (9R,10R)-9,10-dihydrophenanthrene-9,10-diol (CHEBI:27066) |
| Incoming Relation(s) |
| (9R,10R)-9,10-dihydrophenanthrene-9,10-diol (CHEBI:27066) is enantiomer of (9S,10S)-9,10-dihydrophenanthrene-9,10-diol (CHEBI:28951) |
| IUPAC Name |
|---|
| (9S,10S)-9,10-dihydrophenanthrene-9,10-diol |
| Synonym | Source |
|---|---|
| trans-9(S),10(S)-Dihydrodiolphenanthrene | KEGG COMPOUND |