EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5N5O8 |
| Net Charge | 0 |
| Average Mass | 287.144 |
| Monoisotopic Mass | 287.01381 |
| SMILES | CN(c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H5N5O8/c1-8(12(19)20)7-5(10(15)16)2-4(9(13)14)3-6(7)11(17)18/h2-3H,1H3 |
| InChIKey | AGUIVNYEYSCPNI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-N-picrylnitramine (CHEBI:28950) has role explosive (CHEBI:63490) |
| N-methyl-N-picrylnitramine (CHEBI:28950) is a nitramine (CHEBI:25543) |
| IUPAC Name |
|---|
| N-methyl-N,2,4,6-tetranitroaniline |
| Synonyms | Source |
|---|---|
| 2,4,6-tetryl | ChemIDplus |
| 2,4,6-trinitrophenyl-N-methylnitramine | ChemIDplus |
| 2,4,6-trinitrophenylmethylnitramine | ChemIDplus |
| 2,4,6-(trinitrophenyl)methylnitroamine | ChemIDplus |
| N-methyl-N,2,4,6-tetranitroaniline | ChemIDplus |
| N-methyl-N,2,4,6-tetranitrobenzenamine | ChemIDplus |