EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2 |
| Net Charge | 0 |
| Average Mass | 174.247 |
| Monoisotopic Mass | 174.11570 |
| SMILES | CN(C)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,12H,8H2,1-2H3 |
| InChIKey | OCDGBSUVYYVKQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oryza sativa (ncbitaxon:4530) | - | PubMed (23700450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gramine (CHEBI:28948) has role antibacterial agent (CHEBI:33282) |
| gramine (CHEBI:28948) has role antiviral agent (CHEBI:22587) |
| gramine (CHEBI:28948) has role plant metabolite (CHEBI:76924) |
| gramine (CHEBI:28948) has role serotonergic antagonist (CHEBI:48279) |
| gramine (CHEBI:28948) is a aminoalkylindole (CHEBI:38631) |
| gramine (CHEBI:28948) is a indole alkaloid (CHEBI:38958) |
| gramine (CHEBI:28948) is a tertiary amino compound (CHEBI:50996) |
| gramine (CHEBI:28948) is conjugate base of gramine(1+) (CHEBI:136516) |
| Incoming Relation(s) |
| gramine(1+) (CHEBI:136516) is conjugate acid of gramine (CHEBI:28948) |
| IUPAC Name |
|---|
| 1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
| Synonyms | Source |
|---|---|
| (1H-indol-3-ylmethyl)dimethylamine | MetaCyc |
| 3-(Dimethylaminomethyl)indole | ChemIDplus |
| 3-[(Dimethylamino)methyl]indole | NIST Chemistry WebBook |
| 3-(N,N-Dimethylaminomethyl)indole | HMDB |
| beta-Dimethylaminomethylindole | ChemIDplus |
| Donaxin | NIST Chemistry WebBook |
| Citations |
|---|