EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5 |
| Net Charge | 0 |
| Average Mass | 149.157 |
| Monoisotopic Mass | 149.07015 |
| SMILES | Cn1cnc2ncnc(N)c21 |
| InChI | InChI=1S/C6H7N5/c1-11-3-10-6-4(11)5(7)8-2-9-6/h2-3H,1H3,(H2,7,8,9) |
| InChIKey | HCGHYQLFMPXSDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyladenine (CHEBI:28921) has role metabolite (CHEBI:25212) |
| 7-methyladenine (CHEBI:28921) is a methyladenine (CHEBI:25272) |
| IUPAC Name |
|---|
| 7-methyl-7H-purin-6-amine |
| Manual Xrefs | Databases |
|---|---|
| C02241 | KEGG COMPOUND |
| HMDB0011614 | HMDB |
| CPD-13320 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:149647 | Reaxys |
| CAS:935-69-3 | ChemIDplus |
| Citations |
|---|