EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N10O22P5 |
| Net Charge | 0 |
| Average Mass | 916.370 |
| Monoisotopic Mass | 916.01460 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H29N10O22P5/c21-15-9-17(25-3-23-15)29(5-27-9)19-13(33)11(31)7(47-19)1-45-53(35,36)49-55(39,40)51-57(43,44)52-56(41,42)50-54(37,38)46-2-8-12(32)14(34)20(48-8)30-6-28-10-16(22)24-4-26-18(10)30/h3-8,11-14,19-20,31-34H,1-2H2,(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H2,21,23,25)(H2,22,24,26)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1 |
| InChIKey | OIMACDRJUANHTJ-XPWFQUROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| P1,P5-bis(5'-adenosyl) pentaphosphate (CHEBI:28898) has role Escherichia coli metabolite (CHEBI:76971) |
| P1,P5-bis(5'-adenosyl) pentaphosphate (CHEBI:28898) has role vasoconstrictor agent (CHEBI:50514) |
| P1,P5-bis(5'-adenosyl) pentaphosphate (CHEBI:28898) is a diadenosyl pentaphosphate (CHEBI:63737) |
| P1,P5-bis(5'-adenosyl) pentaphosphate (CHEBI:28898) is conjugate acid of P1,P5-bis(5'-adenosyl) pentaphosphate(5−) (CHEBI:62041) |
| Incoming Relation(s) |
| P1,P5-bis(5'-adenosyl) pentaphosphate(5−) (CHEBI:62041) is conjugate base of P1,P5-bis(5'-adenosyl) pentaphosphate (CHEBI:28898) |
| IUPAC Name |
|---|
| adenosine(5')pentaphospho(5')adenosine |
| Synonyms | Source |
|---|---|
| Bis(5'-adenosyl) pentaphosphate | KEGG COMPOUND |
| P1,P5-Bis(5'-adenosyl) pentaphosphate | KEGG COMPOUND |
| P(1),P(5)-Di(adenosine-5'-)pentaphosphate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:604343 | Beilstein |
| CAS:50304-44-4 | ChemIDplus |