EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22NO7PS |
| Net Charge | 0 |
| Average Mass | 343.338 |
| Monoisotopic Mass | 343.08546 |
| SMILES | C[C@@H](OP(=O)(O)O)[C@H](NC(=O)CCCCCCS)C(=O)O |
| InChI | InChI=1S/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)/t8-,10+/m1/s1 |
| InChIKey | JBJSVEVEEGOEBZ-SCZZXKLOSA-N |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coenzyme B (CHEBI:28890) has role coenzyme (CHEBI:23354) |
| coenzyme B (CHEBI:28890) is a L-threonine derivative (CHEBI:84189) |
| coenzyme B (CHEBI:28890) is conjugate acid of coenzyme B(3−) (CHEBI:58596) |
| Incoming Relation(s) |
| coenzyme B(3−) (CHEBI:58596) is conjugate base of coenzyme B (CHEBI:28890) |
| IUPAC Name |
|---|
| N-(7-sulfanylheptanoyl)-L-threonine 3-(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| N-(7-Mercaptoheptanoyl)threonine 3-O-phosphate | KEGG COMPOUND |
| N-(7-Mercaptoheptanoyl)threonine O3-phosphate | KEGG COMPOUND |
| Coenzyme B | KEGG COMPOUND |
| HTP | KEGG COMPOUND |
| N-(7-sulfanylheptanoyl)-3-O-phosphono-L-threonine | IUBMB |
| N-(7-sulfanylheptanoyl)-3-phospho-L-threonine | IUBMB |
| Registry Numbers | Sources |
|---|---|
| CAS:104302-77-4 | ChemIDplus |