EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N4 |
| Net Charge | 0 |
| Average Mass | 136.158 |
| Monoisotopic Mass | 136.07490 |
| SMILES | c1ncc2c(n1)NCCN2 |
| InChI | InChI=1S/C6H8N4/c1-2-9-6-5(8-1)3-7-4-10-6/h3-4,8H,1-2H2,(H,7,9,10) |
| InChIKey | IDAICLIJTRXNER-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,7,8-tetrahydropteridine (CHEBI:28889) has role Escherichia coli metabolite (CHEBI:76971) |
| 5,6,7,8-tetrahydropteridine (CHEBI:28889) has role cofactor (CHEBI:23357) |
| 5,6,7,8-tetrahydropteridine (CHEBI:28889) is a pteridines (CHEBI:26373) |
| IUPAC Name |
|---|
| 5,6,7,8-tetrahydropteridine |
| Synonyms | Source |
|---|---|
| 5,6,7,8-Tetrahydropteridine | KEGG COMPOUND |
| Tetrahydropteridine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 5,6,7,8-tetrahydropteridine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:134888 | Beilstein |
| CAS:10593-78-9 | ChemIDplus |