EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O3 |
| Net Charge | 0 |
| Average Mass | 164.160 |
| Monoisotopic Mass | 164.04734 |
| SMILES | O=C(O)/C=C\c1ccccc1O |
| InChI | InChI=1S/C9H8O3/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-6,10H,(H,11,12)/b6-5- |
| InChIKey | PMOWTIHVNWZYFI-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-2-coumaric acid (CHEBI:28873) is a 2-coumaric acid (CHEBI:18176) |
| cis-2-coumaric acid (CHEBI:28873) is conjugate acid of cis-2-coumarate (CHEBI:47921) |
| Incoming Relation(s) |
| 2-(β-D-glucosyloxy)-cis-cinnamic acid (CHEBI:62251) has functional parent cis-2-coumaric acid (CHEBI:28873) |
| cis-2-coumarate (CHEBI:47921) is conjugate base of cis-2-coumaric acid (CHEBI:28873) |
| IUPAC Name |
|---|
| (2Z)-3-(2-hydroxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 2-Coumarinate | KEGG COMPOUND |
| (2Z)-3-(2-hydroxyphenyl)acrylic acid | ChEBI |
| cis-2-Hydroxy cinnamate | KEGG COMPOUND |
| cis-2-hydroxycinnamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05838 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2207353 | Beilstein |
| Reaxys:2207353 | Reaxys |